C20H13Cl2FN4S — CID 156832923
6-[3-[(2,5-dichlorophenyl)sulfanylamino]-2-fluorophenyl]quinazolin-2-amine (PubChem CID 156832923) has the molecular formula C20H13Cl2FN4S and a molecular weight of 431.32 g/mol. Its IUPAC name is 6-[3-[(2,5-dichlorophenyl)sulfanylamino]-2-fluorophenyl]quinazolin-2-amine.
| Compound Name | 6-[3-[(2,5-dichlorophenyl)sulfanylamino]-2-fluorophenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 156832923 |
| Molecular Formula | C20H13Cl2FN4S |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 6-[3-[(2,5-dichlorophenyl)sulfanylamino]-2-fluorophenyl]quinazolin-2-amine |
| SMILES | Nc1ncc2cc(-c3cccc(NSc4cc(Cl)ccc4Cl)c3F)ccc2n1 |
| InChI | InChI=1S/C20H13Cl2FN4S/c21-13-5-6-15(22)18(9-13)28-27-17-3-1-2-14(19(17)23)11-4-7-16-12(8-11)10-25-20(24)26-16/h1-10,27H,(H2,24,25,26) |
| InChIKey | UBXUXGPWINQFRX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|