C22H16Cl2N4O2S — CID 167484126
6-[1-(2,5-dichlorophenyl)sulfonyl-2,3-dihydroindol-4-yl]quinazolin-2-amine (PubChem CID 167484126) has the molecular formula C22H16Cl2N4O2S and a molecular weight of 471.37 g/mol. Its IUPAC name is 6-[1-(2,5-dichlorophenyl)sulfonyl-2,3-dihydroindol-4-yl]quinazolin-2-amine.
| Compound Name | 6-[1-(2,5-dichlorophenyl)sulfonyl-2,3-dihydroindol-4-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 167484126 |
| Molecular Formula | C22H16Cl2N4O2S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 6-[1-(2,5-dichlorophenyl)sulfonyl-2,3-dihydroindol-4-yl]quinazolin-2-amine |
| SMILES | Nc1ncc2cc(-c3cccc4c3CCN4S(=O)(=O)c3cc(Cl)ccc3Cl)ccc2n1 |
| InChI | InChI=1S/C22H16Cl2N4O2S/c23-15-5-6-18(24)21(11-15)31(29,30)28-9-8-17-16(2-1-3-20(17)28)13-4-7-19-14(10-13)12-26-22(25)27-19/h1-7,10-12H,8-9H2,(H2,25,26,27) |
| InChIKey | PUHSUQMPYFWOIN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |