C15H12Cl2FNO2S — CID 24656900
1-(2,5-dichlorophenyl)sulfonyl-8-fluoro-3,4-dihydro-2H-quinoline (PubChem CID 24656900) has the molecular formula C15H12Cl2FNO2S and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-8-fluoro-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-8-fluoro-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 24656900 |
| Molecular Formula | C15H12Cl2FNO2S |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-8-fluoro-3,4-dihydro-2H-quinoline |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CCCc2cccc(F)c21 |
| InChI | InChI=1S/C15H12Cl2FNO2S/c16-11-6-7-12(17)14(9-11)22(20,21)19-8-2-4-10-3-1-5-13(18)15(10)19/h1,3,5-7,9H,2,4,8H2 |
| InChIKey | GYSMHWBXJMCKPG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |