C14H12ClFN2O2S — CID 24656598
1-[(2-chloro-3-pyridinyl)sulfonyl]-8-fluoro-3,4-dihydro-2H-quinoline (PubChem CID 24656598) has the molecular formula C14H12ClFN2O2S and a molecular weight of 326.78 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-8-fluoro-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-8-fluoro-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 24656598 |
| Molecular Formula | C14H12ClFN2O2S |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-8-fluoro-3,4-dihydro-2H-quinoline |
| SMILES | O=S(=O)(c1cccnc1Cl)N1CCCc2cccc(F)c21 |
| InChI | InChI=1S/C14H12ClFN2O2S/c15-14-12(7-2-8-17-14)21(19,20)18-9-3-5-10-4-1-6-11(16)13(10)18/h1-2,4,6-8H,3,5,9H2 |
| InChIKey | QKPMSXUFQJCHFC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|