C11H13ClF3N3O2S — CID 61051712
1-[(2-chloro-3-pyridinyl)sulfonyl]-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 61051712) has the molecular formula C11H13ClF3N3O2S and a molecular weight of 343.76 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 61051712 |
| Molecular Formula | C11H13ClF3N3O2S |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | O=S(=O)(c1cccnc1Cl)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H13ClF3N3O2S/c12-10-9(2-1-3-16-10)21(19,20)18-6-4-17(5-7-18)8-11(13,14)15/h1-3H,4-8H2 |
| InChIKey | NGFZZPCGQPXBQL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|