C17H17ClF3N3O2S — CID 46644063
1-[4-chloro-2-(trifluoromethyl)phenyl]sulfonyl-4-(pyridin-2-ylmethyl)piperazine (PubChem CID 46644063) has the molecular formula C17H17ClF3N3O2S and a molecular weight of 419.86 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]sulfonyl-4-(pyridin-2-ylmethyl)piperazine.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]sulfonyl-4-(pyridin-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 46644063 |
| Molecular Formula | C17H17ClF3N3O2S |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]sulfonyl-4-(pyridin-2-ylmethyl)piperazine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1C(F)(F)F)N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C17H17ClF3N3O2S/c18-13-4-5-16(15(11-13)17(19,20)21)27(25,26)24-9-7-23(8-10-24)12-14-3-1-2-6-22-14/h1-6,11H,7-10,12H2 |
| InChIKey | DTUVHIYOKHNWML-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |