C17H20ClN3O2S — CID 27175600
1-(4-chlorophenyl)sulfonyl-4-(2-pyridin-2-ylethyl)piperazine (PubChem CID 27175600) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-(2-pyridin-2-ylethyl)piperazine.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-(2-pyridin-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 27175600 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-(2-pyridin-2-ylethyl)piperazine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN(CCc2ccccn2)CC1 |
| InChI | InChI=1S/C17H20ClN3O2S/c18-15-4-6-17(7-5-15)24(22,23)21-13-11-20(12-14-21)10-8-16-3-1-2-9-19-16/h1-7,9H,8,10-14H2 |
| InChIKey | RLNUADLYWDCHCC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |