C10H12BrF3N2O3S — CID 136530775
1-(5-bromofuran-2-yl)sulfonyl-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 136530775) has the molecular formula C10H12BrF3N2O3S and a molecular weight of 377.18 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)sulfonyl-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-(5-bromofuran-2-yl)sulfonyl-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 136530775 |
| Molecular Formula | C10H12BrF3N2O3S |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 1-(5-bromofuran-2-yl)sulfonyl-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | O=S(=O)(c1ccc(Br)o1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H12BrF3N2O3S/c11-8-1-2-9(19-8)20(17,18)16-5-3-15(4-6-16)7-10(12,13)14/h1-2H,3-7H2 |
| InChIKey | ZIDVEHGBKBGCAV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |