C8H12BrClN2O3S — CID 120708380
1-(5-bromofuran-2-yl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 120708380) has the molecular formula C8H12BrClN2O3S and a molecular weight of 331.62 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-(5-bromofuran-2-yl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120708380 |
| Molecular Formula | C8H12BrClN2O3S |
| Molecular Weight | 331.62 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | 1-(5-bromofuran-2-yl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(S(=O)(=O)c2ccc(Br)o2)C1 |
| InChI | InChI=1S/C8H11BrN2O3S.ClH/c9-7-1-2-8(14-7)15(12,13)11-4-3-6(10)5-11;/h1-2,6H,3-5,10H2;1H |
| InChIKey | IIZFCJMDGABCQR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.62 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |