C23H21F3N4S — CID 156833105
6-[2,6-difluoro-3-[(3-fluoro-4-methylphenyl)sulfanylamino]phenyl]quinazolin-2-amine;ethane (PubChem CID 156833105) has the molecular formula C23H21F3N4S and a molecular weight of 442.51 g/mol. Its IUPAC name is 6-[2,6-difluoro-3-[(3-fluoro-4-methylphenyl)sulfanylamino]phenyl]quinazolin-2-amine;ethane.
| Compound Name | 6-[2,6-difluoro-3-[(3-fluoro-4-methylphenyl)sulfanylamino]phenyl]quinazolin-2-amine;ethane |
|---|---|
| PubChem CID | 156833105 |
| Molecular Formula | C23H21F3N4S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 6-[2,6-difluoro-3-[(3-fluoro-4-methylphenyl)sulfanylamino]phenyl]quinazolin-2-amine;ethane |
| SMILES | CC.Cc1ccc(SNc2ccc(F)c(-c3ccc4nc(N)ncc4c3)c2F)cc1F |
| InChI | InChI=1S/C21H15F3N4S.C2H6/c1-11-2-4-14(9-16(11)23)29-28-18-7-5-15(22)19(20(18)24)12-3-6-17-13(8-12)10-26-21(25)27-17;1-2/h2-10,28H,1H3,(H2,25,26,27);1-2H3 |
| InChIKey | GCQSWQSZOJAWQG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|