C19H23F2N3 — CID 156832886
2,4-difluoro-3-(2-methylquinazolin-6-yl)aniline;ethane (PubChem CID 156832886) has the molecular formula C19H23F2N3 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2,4-difluoro-3-(2-methylquinazolin-6-yl)aniline;ethane.
| Compound Name | 2,4-difluoro-3-(2-methylquinazolin-6-yl)aniline;ethane |
|---|---|
| PubChem CID | 156832886 |
| Molecular Formula | C19H23F2N3 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2,4-difluoro-3-(2-methylquinazolin-6-yl)aniline;ethane |
| SMILES | CC.CC.Cc1ncc2cc(-c3c(F)ccc(N)c3F)ccc2n1 |
| InChI | InChI=1S/C15H11F2N3.2C2H6/c1-8-19-7-10-6-9(2-5-13(10)20-8)14-11(16)3-4-12(18)15(14)17;2*1-2/h2-7H,18H2,1H3;2*1-2H3 |
| InChIKey | PMDGPSUDKNLQBL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|