C14H11F2N5O — CID 170437515
2-amino-6-(3-amino-2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 170437515) has the molecular formula C14H11F2N5O and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-amino-6-(3-amino-2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-6-(3-amino-2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 170437515 |
| Molecular Formula | C14H11F2N5O |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-amino-6-(3-amino-2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1c(=O)c(-c2c(F)ccc(N)c2F)cc2cnc(N)nc21 |
| InChI | InChI=1S/C14H11F2N5O/c1-21-12-6(5-19-14(18)20-12)4-7(13(21)22)10-8(15)2-3-9(17)11(10)16/h2-5H,17H2,1H3,(H2,18,19,20) |
| InChIKey | UDENCIIVBLUWHM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|