C18H18F2N5O+ — CID 164529693
6-(3-amino-2,6-difluorophenyl)-2-(cyclopropylmethylamino)-8-methylpyrido[2,3-d]pyrimidin-3-ium-7-one (PubChem CID 164529693) has the molecular formula C18H18F2N5O+ and a molecular weight of 358.37 g/mol. Its IUPAC name is 6-(3-amino-2,6-difluorophenyl)-2-(cyclopropylmethylamino)-8-methylpyrido[2,3-d]pyrimidin-3-ium-7-one.
| Compound Name | 6-(3-amino-2,6-difluorophenyl)-2-(cyclopropylmethylamino)-8-methylpyrido[2,3-d]pyrimidin-3-ium-7-one |
|---|---|
| PubChem CID | 164529693 |
| Molecular Formula | C18H18F2N5O+ |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 6-(3-amino-2,6-difluorophenyl)-2-(cyclopropylmethylamino)-8-methylpyrido[2,3-d]pyrimidin-3-ium-7-one |
| SMILES | Cn1c(=O)c(-c2c(F)ccc(N)c2F)cc2c[nH+]c(NCC3CC3)nc21 |
| InChI | InChI=1S/C18H17F2N5O/c1-25-16-10(8-23-18(24-16)22-7-9-2-3-9)6-11(17(25)26)14-12(19)4-5-13(21)15(14)20/h4-6,8-9H,2-3,7,21H2,1H3,(H,22,23,24)/p+1 |
| InChIKey | CQGILXKDIPTHKB-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|