C18H21FN6O — CID 69036825
6-(3-amino-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 69036825) has the molecular formula C18H21FN6O and a molecular weight of 356.41 g/mol. Its IUPAC name is 6-(3-amino-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(3-amino-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 69036825 |
| Molecular Formula | C18H21FN6O |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 6-(3-amino-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN(C)CCNc1ncc2cc(-c3ccc(F)c(N)c3)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C18H21FN6O/c1-24(2)7-6-21-18-22-10-12-8-13(17(26)25(3)16(12)23-18)11-4-5-14(19)15(20)9-11/h4-5,8-10H,6-7,20H2,1-3H3,(H,21,22,23) |
| InChIKey | QUOREWDUPBSSDQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|