C20H11Cl3F2N4S — CID 156832892
6-[2,6-difluoro-3-[(2,4,5-trichlorophenyl)sulfanylamino]phenyl]quinazolin-2-amine (PubChem CID 156832892) has the molecular formula C20H11Cl3F2N4S and a molecular weight of 483.76 g/mol. Its IUPAC name is 6-[2,6-difluoro-3-[(2,4,5-trichlorophenyl)sulfanylamino]phenyl]quinazolin-2-amine.
| Compound Name | 6-[2,6-difluoro-3-[(2,4,5-trichlorophenyl)sulfanylamino]phenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 156832892 |
| Molecular Formula | C20H11Cl3F2N4S |
| Molecular Weight | 483.76 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | 6-[2,6-difluoro-3-[(2,4,5-trichlorophenyl)sulfanylamino]phenyl]quinazolin-2-amine |
| SMILES | Nc1ncc2cc(-c3c(F)ccc(NSc4cc(Cl)c(Cl)cc4Cl)c3F)ccc2n1 |
| InChI | InChI=1S/C20H11Cl3F2N4S/c21-11-6-13(23)17(7-12(11)22)30-29-16-4-2-14(24)18(19(16)25)9-1-3-15-10(5-9)8-27-20(26)28-15/h1-8,29H,(H2,26,27,28) |
| InChIKey | REAYTBTULMFGQH-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.76 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|