C24H20Cl2F2N4O2S — CID 168723972
(2R)-2-[[6-[3-[[2,5-dichloro-3-(hydroxymethyl)phenyl]sulfanylamino]-2,6-difluorophenyl]quinazolin-2-yl]amino]propan-1-ol (PubChem CID 168723972) has the molecular formula C24H20Cl2F2N4O2S and a molecular weight of 537.42 g/mol. Its IUPAC name is (2R)-2-[[6-[3-[[2,5-dichloro-3-(hydroxymethyl)phenyl]sulfanylamino]-2,6-difluorophenyl]quinazolin-2-yl]amino]propan-1-ol.
| Compound Name | (2R)-2-[[6-[3-[[2,5-dichloro-3-(hydroxymethyl)phenyl]sulfanylamino]-2,6-difluorophenyl]quinazolin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 168723972 |
| Molecular Formula | C24H20Cl2F2N4O2S |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | (2R)-2-[[6-[3-[[2,5-dichloro-3-(hydroxymethyl)phenyl]sulfanylamino]-2,6-difluorophenyl]quinazolin-2-yl]amino]propan-1-ol |
| SMILES | C[C@H](CO)Nc1ncc2cc(-c3c(F)ccc(NSc4cc(Cl)cc(CO)c4Cl)c3F)ccc2n1 |
| InChI | InChI=1S/C24H20Cl2F2N4O2S/c1-12(10-33)30-24-29-9-14-6-13(2-4-18(14)31-24)21-17(27)3-5-19(23(21)28)32-35-20-8-16(25)7-15(11-34)22(20)26/h2-9,12,32-34H,10-11H2,1H3,(H,29,30,31)/t12-/m1/s1 |
| InChIKey | IWRMTSMXBKQRQU-GFCCVEGCSA-N |
| XLogP | 6.29 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|