C23H18ClF2N3OS — CID 142488942
N-(2-chlorophenyl)sulfanyl-4-(8-ethyl-2-fluoroquinazolin-6-yl)-2-fluoro-5-methoxyaniline (PubChem CID 142488942) has the molecular formula C23H18ClF2N3OS and a molecular weight of 457.93 g/mol. Its IUPAC name is N-(2-chlorophenyl)sulfanyl-4-(8-ethyl-2-fluoroquinazolin-6-yl)-2-fluoro-5-methoxyaniline.
| Compound Name | N-(2-chlorophenyl)sulfanyl-4-(8-ethyl-2-fluoroquinazolin-6-yl)-2-fluoro-5-methoxyaniline |
|---|---|
| PubChem CID | 142488942 |
| Molecular Formula | C23H18ClF2N3OS |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-(2-chlorophenyl)sulfanyl-4-(8-ethyl-2-fluoroquinazolin-6-yl)-2-fluoro-5-methoxyaniline |
| SMILES | CCc1cc(-c2cc(F)c(NSc3ccccc3Cl)cc2OC)cc2cnc(F)nc12 |
| InChI | InChI=1S/C23H18ClF2N3OS/c1-3-13-8-14(9-15-12-27-23(26)28-22(13)15)16-10-18(25)19(11-20(16)30-2)29-31-21-7-5-4-6-17(21)24/h4-12,29H,3H2,1-2H3 |
| InChIKey | RMYIUPLQGNMTPE-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|