C6H2BrCl2F — CID 19779824
2-bromo-1,3-dichloro-4-fluorobenzene (PubChem CID 19779824) has the molecular formula C6H2BrCl2F and a molecular weight of 243.89 g/mol. Its IUPAC name is 2-bromo-1,3-dichloro-4-fluorobenzene.
| Compound Name | 2-bromo-1,3-dichloro-4-fluorobenzene |
|---|---|
| PubChem CID | 19779824 |
| Molecular Formula | C6H2BrCl2F |
| Molecular Weight | 243.89 g/mol |
| Exact Mass | 241.87 |
| IUPAC Name | 2-bromo-1,3-dichloro-4-fluorobenzene |
| SMILES | Fc1ccc(Cl)c(Br)c1Cl |
| InChI | InChI=1S/C6H2BrCl2F/c7-5-3(8)1-2-4(10)6(5)9/h1-2H |
| InChIKey | PSFKDXYTCKEBSN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|