C13H10Cl3NS2 — CID 130412201
5-chloro-N-(3,4-dichlorophenyl)sulfanyl-2-methylsulfanylaniline (PubChem CID 130412201) has the molecular formula C13H10Cl3NS2 and a molecular weight of 350.72 g/mol. Its IUPAC name is 5-chloro-N-(3,4-dichlorophenyl)sulfanyl-2-methylsulfanylaniline.
| Compound Name | 5-chloro-N-(3,4-dichlorophenyl)sulfanyl-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 130412201 |
| Molecular Formula | C13H10Cl3NS2 |
| Molecular Weight | 350.72 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | 5-chloro-N-(3,4-dichlorophenyl)sulfanyl-2-methylsulfanylaniline |
| SMILES | CSc1ccc(Cl)cc1NSc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl3NS2/c1-18-13-5-2-8(14)6-12(13)17-19-9-3-4-10(15)11(16)7-9/h2-7,17H,1H3 |
| InChIKey | HRGWCRISVWPVMW-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.72 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|