C13H8BrCl2F2NO3S — CID 176863719
N-(3-bromo-2,4-difluorophenyl)-2,5-dichloro-3-(hydroxymethyl)benzenesulfonamide (PubChem CID 176863719) has the molecular formula C13H8BrCl2F2NO3S and a molecular weight of 447.08 g/mol. Its IUPAC name is N-(3-bromo-2,4-difluorophenyl)-2,5-dichloro-3-(hydroxymethyl)benzenesulfonamide.
| Compound Name | N-(3-bromo-2,4-difluorophenyl)-2,5-dichloro-3-(hydroxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 176863719 |
| Molecular Formula | C13H8BrCl2F2NO3S |
| Molecular Weight | 447.08 g/mol |
| Exact Mass | 444.88 |
| IUPAC Name | N-(3-bromo-2,4-difluorophenyl)-2,5-dichloro-3-(hydroxymethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(Br)c1F)c1cc(Cl)cc(CO)c1Cl |
| InChI | InChI=1S/C13H8BrCl2F2NO3S/c14-11-8(17)1-2-9(13(11)18)19-23(21,22)10-4-7(15)3-6(5-20)12(10)16/h1-4,19-20H,5H2 |
| InChIKey | NNRWEPQKKURPKG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.08 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|