C14H13BrClNO4S — CID 3518295
5-bromo-N-[4-chloro-2-(hydroxymethyl)phenyl]-2-methoxybenzenesulfonamide (PubChem CID 3518295) has the molecular formula C14H13BrClNO4S and a molecular weight of 406.69 g/mol. Its IUPAC name is 5-bromo-N-[4-chloro-2-(hydroxymethyl)phenyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[4-chloro-2-(hydroxymethyl)phenyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3518295 |
| Molecular Formula | C14H13BrClNO4S |
| Molecular Weight | 406.69 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | 5-bromo-N-[4-chloro-2-(hydroxymethyl)phenyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)Nc1ccc(Cl)cc1CO |
| InChI | InChI=1S/C14H13BrClNO4S/c1-21-13-5-2-10(15)7-14(13)22(19,20)17-12-4-3-11(16)6-9(12)8-18/h2-7,17-18H,8H2,1H3 |
| InChIKey | JKPWASJDNBWWQN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.69 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |