C15H15BrClNO3S — CID 74225212
5-bromo-N-(2-chloro-4,6-dimethylphenyl)-2-methoxybenzenesulfonamide (PubChem CID 74225212) has the molecular formula C15H15BrClNO3S and a molecular weight of 404.71 g/mol. Its IUPAC name is 5-bromo-N-(2-chloro-4,6-dimethylphenyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-(2-chloro-4,6-dimethylphenyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 74225212 |
| Molecular Formula | C15H15BrClNO3S |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | 5-bromo-N-(2-chloro-4,6-dimethylphenyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C15H15BrClNO3S/c1-9-6-10(2)15(12(17)7-9)18-22(19,20)14-8-11(16)4-5-13(14)21-3/h4-8,18H,1-3H3 |
| InChIKey | PJTJGBUOSDQHRT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |