C10H10BrN3O3S — CID 56684268
5-bromo-2-methoxy-N-(1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 56684268) has the molecular formula C10H10BrN3O3S and a molecular weight of 332.18 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(1H-pyrazol-5-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-(1H-pyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 56684268 |
| Molecular Formula | C10H10BrN3O3S |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 5-bromo-2-methoxy-N-(1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C10H10BrN3O3S/c1-17-8-3-2-7(11)6-9(8)18(15,16)14-10-4-5-12-13-10/h2-6H,1H3,(H2,12,13,14) |
| InChIKey | BSDSRCGVTCGRNG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |