C18H12Cl2FN5O3S — CID 168678333
N-[4-[2-(2-aminopyrimidin-5-yl)ethynyl]-3-fluoro-2-pyridinyl]-2,5-dichloro-3-(hydroxymethyl)benzenesulfonamide (PubChem CID 168678333) has the molecular formula C18H12Cl2FN5O3S and a molecular weight of 468.30 g/mol. Its IUPAC name is N-[4-[2-(2-aminopyrimidin-5-yl)ethynyl]-3-fluoro-2-pyridinyl]-2,5-dichloro-3-(hydroxymethyl)benzenesulfonamide.
| Compound Name | N-[4-[2-(2-aminopyrimidin-5-yl)ethynyl]-3-fluoro-2-pyridinyl]-2,5-dichloro-3-(hydroxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168678333 |
| Molecular Formula | C18H12Cl2FN5O3S |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | N-[4-[2-(2-aminopyrimidin-5-yl)ethynyl]-3-fluoro-2-pyridinyl]-2,5-dichloro-3-(hydroxymethyl)benzenesulfonamide |
| SMILES | Nc1ncc(C#Cc2ccnc(NS(=O)(=O)c3cc(Cl)cc(CO)c3Cl)c2F)cn1 |
| InChI | InChI=1S/C18H12Cl2FN5O3S/c19-13-5-12(9-27)15(20)14(6-13)30(28,29)26-17-16(21)11(3-4-23-17)2-1-10-7-24-18(22)25-8-10/h3-8,27H,9H2,(H,23,26)(H2,22,24,25) |
| InChIKey | CLVRTGFOLCQHMN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|