C18H13Cl2N5O3S — CID 138675810
N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2-chlorophenyl]-5-chloro-2-methoxypyridine-3-sulfonamide (PubChem CID 138675810) has the molecular formula C18H13Cl2N5O3S and a molecular weight of 450.31 g/mol. Its IUPAC name is N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2-chlorophenyl]-5-chloro-2-methoxypyridine-3-sulfonamide.
| Compound Name | N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2-chlorophenyl]-5-chloro-2-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 138675810 |
| Molecular Formula | C18H13Cl2N5O3S |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2-chlorophenyl]-5-chloro-2-methoxypyridine-3-sulfonamide |
| SMILES | COc1ncc(Cl)cc1S(=O)(=O)Nc1cccc(C#Cc2cnc(N)nc2)c1Cl |
| InChI | InChI=1S/C18H13Cl2N5O3S/c1-28-17-15(7-13(19)10-22-17)29(26,27)25-14-4-2-3-12(16(14)20)6-5-11-8-23-18(21)24-9-11/h2-4,7-10,25H,1H3,(H2,21,23,24) |
| InChIKey | ILTLDLJJHKCMDG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|