C19H11ClF4N4O3S — CID 138675672
N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]-5-chloro-2-(difluoromethoxy)benzenesulfonamide (PubChem CID 138675672) has the molecular formula C19H11ClF4N4O3S and a molecular weight of 486.83 g/mol. Its IUPAC name is N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]-5-chloro-2-(difluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]-5-chloro-2-(difluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 138675672 |
| Molecular Formula | C19H11ClF4N4O3S |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]-5-chloro-2-(difluoromethoxy)benzenesulfonamide |
| SMILES | Nc1ncc(C#Cc2c(F)ccc(NS(=O)(=O)c3cc(Cl)ccc3OC(F)F)c2F)cn1 |
| InChI | InChI=1S/C19H11ClF4N4O3S/c20-11-2-6-15(31-18(23)24)16(7-11)32(29,30)28-14-5-4-13(21)12(17(14)22)3-1-10-8-26-19(25)27-9-10/h2,4-9,18,28H,(H2,25,26,27) |
| InChIKey | JOPCRCLYVKCGEF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|