C20H15F2N5O4S — CID 138676204
3-[[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]sulfamoyl]-4-methoxybenzamide (PubChem CID 138676204) has the molecular formula C20H15F2N5O4S and a molecular weight of 459.43 g/mol. Its IUPAC name is 3-[[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]sulfamoyl]-4-methoxybenzamide.
| Compound Name | 3-[[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]sulfamoyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 138676204 |
| Molecular Formula | C20H15F2N5O4S |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-[[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]sulfamoyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1S(=O)(=O)Nc1ccc(F)c(C#Cc2cnc(N)nc2)c1F |
| InChI | InChI=1S/C20H15F2N5O4S/c1-31-16-7-3-12(19(23)28)8-17(16)32(29,30)27-15-6-5-14(21)13(18(15)22)4-2-11-9-25-20(24)26-10-11/h3,5-10,27H,1H3,(H2,23,28)(H2,24,25,26) |
| InChIKey | GVWPMMFOFLXBGJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|