C19H14F2N4O3S — CID 138675973
N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]-4-methoxybenzenesulfonamide (PubChem CID 138675973) has the molecular formula C19H14F2N4O3S and a molecular weight of 416.41 g/mol. Its IUPAC name is N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 138675973 |
| Molecular Formula | C19H14F2N4O3S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]-2,4-difluorophenyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(F)c(C#Cc3cnc(N)nc3)c2F)cc1 |
| InChI | InChI=1S/C19H14F2N4O3S/c1-28-13-3-5-14(6-4-13)29(26,27)25-17-9-8-16(20)15(18(17)21)7-2-12-10-23-19(22)24-11-12/h3-6,8-11,25H,1H3,(H2,22,23,24) |
| InChIKey | TYPDYQAVGGOLNJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|