C21H16Cl2F2N4O2S — CID 138675678
2,5-dichloro-N-[2,4-difluoro-3-[2-[2-(propan-2-ylamino)pyrimidin-5-yl]ethynyl]phenyl]benzenesulfonamide (PubChem CID 138675678) has the molecular formula C21H16Cl2F2N4O2S and a molecular weight of 497.35 g/mol. Its IUPAC name is 2,5-dichloro-N-[2,4-difluoro-3-[2-[2-(propan-2-ylamino)pyrimidin-5-yl]ethynyl]phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2,4-difluoro-3-[2-[2-(propan-2-ylamino)pyrimidin-5-yl]ethynyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138675678 |
| Molecular Formula | C21H16Cl2F2N4O2S |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 2,5-dichloro-N-[2,4-difluoro-3-[2-[2-(propan-2-ylamino)pyrimidin-5-yl]ethynyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)Nc1ncc(C#Cc2c(F)ccc(NS(=O)(=O)c3cc(Cl)ccc3Cl)c2F)cn1 |
| InChI | InChI=1S/C21H16Cl2F2N4O2S/c1-12(2)28-21-26-10-13(11-27-21)3-5-15-17(24)7-8-18(20(15)25)29-32(30,31)19-9-14(22)4-6-16(19)23/h4,6-12,29H,1-2H3,(H,26,27,28) |
| InChIKey | BVRROFBRTGNDBC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|