C24H20Cl2F2N4O3S — CID 138675675
2,5-dichloro-N-[2,4-difluoro-3-[2-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-5-yl]ethynyl]phenyl]benzenesulfonamide (PubChem CID 138675675) has the molecular formula C24H20Cl2F2N4O3S and a molecular weight of 553.42 g/mol. Its IUPAC name is 2,5-dichloro-N-[2,4-difluoro-3-[2-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-5-yl]ethynyl]phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2,4-difluoro-3-[2-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-5-yl]ethynyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138675675 |
| Molecular Formula | C24H20Cl2F2N4O3S |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | 2,5-dichloro-N-[2,4-difluoro-3-[2-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-5-yl]ethynyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(C#Cc2cnc(NC3CCC(O)CC3)nc2)c1F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C24H20Cl2F2N4O3S/c25-15-2-8-19(26)22(11-15)36(34,35)32-21-10-9-20(27)18(23(21)28)7-1-14-12-29-24(30-13-14)31-16-3-5-17(33)6-4-16/h2,8-13,16-17,32-33H,3-6H2,(H,29,30,31) |
| InChIKey | YQVQFZGUWWEVRG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|