C20H10Cl2F2N4O2S — CID 138675799
3,5-dichloro-N-[2,4-difluoro-3-[2-(1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]phenyl]benzenesulfonamide (PubChem CID 138675799) has the molecular formula C20H10Cl2F2N4O2S and a molecular weight of 479.30 g/mol. Its IUPAC name is 3,5-dichloro-N-[2,4-difluoro-3-[2-(1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]phenyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[2,4-difluoro-3-[2-(1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138675799 |
| Molecular Formula | C20H10Cl2F2N4O2S |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | 3,5-dichloro-N-[2,4-difluoro-3-[2-(1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(C#Cc2cnc3[nH]ncc3c2)c1F)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H10Cl2F2N4O2S/c21-13-6-14(22)8-15(7-13)31(29,30)28-18-4-3-17(23)16(19(18)24)2-1-11-5-12-10-26-27-20(12)25-9-11/h3-10,28H,(H,25,26,27) |
| InChIKey | JOIYHKFUQIOFCH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|