C20H11F3N4S — CID 138718924
2,4-difluoro-N-(2-fluorophenyl)sulfanyl-3-[2-(1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]aniline (PubChem CID 138718924) has the molecular formula C20H11F3N4S and a molecular weight of 396.40 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-fluorophenyl)sulfanyl-3-[2-(1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]aniline.
| Compound Name | 2,4-difluoro-N-(2-fluorophenyl)sulfanyl-3-[2-(1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]aniline |
|---|---|
| PubChem CID | 138718924 |
| Molecular Formula | C20H11F3N4S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2,4-difluoro-N-(2-fluorophenyl)sulfanyl-3-[2-(1H-pyrazolo[5,4-b]pyridin-5-yl)ethynyl]aniline |
| SMILES | Fc1ccccc1SNc1ccc(F)c(C#Cc2cnc3[nH]ncc3c2)c1F |
| InChI | InChI=1S/C20H11F3N4S/c21-15-7-8-17(27-28-18-4-2-1-3-16(18)22)19(23)14(15)6-5-12-9-13-11-25-26-20(13)24-10-12/h1-4,7-11,27H,(H,24,25,26) |
| InChIKey | JZJANQZHVYHBSW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|