C19H10Cl2F2N2O2S — CID 158343711
5-[2-[3-[(2,5-dichlorophenyl)sulfonylmethyl]-2,6-difluorophenyl]ethynyl]pyrimidine (PubChem CID 158343711) has the molecular formula C19H10Cl2F2N2O2S and a molecular weight of 439.27 g/mol. Its IUPAC name is 5-[2-[3-[(2,5-dichlorophenyl)sulfonylmethyl]-2,6-difluorophenyl]ethynyl]pyrimidine.
| Compound Name | 5-[2-[3-[(2,5-dichlorophenyl)sulfonylmethyl]-2,6-difluorophenyl]ethynyl]pyrimidine |
|---|---|
| PubChem CID | 158343711 |
| Molecular Formula | C19H10Cl2F2N2O2S |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 5-[2-[3-[(2,5-dichlorophenyl)sulfonylmethyl]-2,6-difluorophenyl]ethynyl]pyrimidine |
| SMILES | O=S(=O)(Cc1ccc(F)c(C#Cc2cncnc2)c1F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H10Cl2F2N2O2S/c20-14-3-5-16(21)18(7-14)28(26,27)10-13-2-6-17(22)15(19(13)23)4-1-12-8-24-11-25-9-12/h2-3,5-9,11H,10H2 |
| InChIKey | GRLVHIKKLDGXNV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|