C15H9Cl2F2NO2S — CID 142751728
2,5-dichloro-N-[(3-ethynyl-2,4-difluorophenyl)methyl]benzenesulfonamide (PubChem CID 142751728) has the molecular formula C15H9Cl2F2NO2S and a molecular weight of 376.21 g/mol. Its IUPAC name is 2,5-dichloro-N-[(3-ethynyl-2,4-difluorophenyl)methyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[(3-ethynyl-2,4-difluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142751728 |
| Molecular Formula | C15H9Cl2F2NO2S |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 2,5-dichloro-N-[(3-ethynyl-2,4-difluorophenyl)methyl]benzenesulfonamide |
| SMILES | C#Cc1c(F)ccc(CNS(=O)(=O)c2cc(Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C15H9Cl2F2NO2S/c1-2-11-13(18)6-3-9(15(11)19)8-20-23(21,22)14-7-10(16)4-5-12(14)17/h1,3-7,20H,8H2 |
| InChIKey | SKBCZWXBMATBNX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|