C14H12Cl2FNO2S — CID 5017965
N-[(2,5-dichlorophenyl)methyl]-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 5017965) has the molecular formula C14H12Cl2FNO2S and a molecular weight of 348.23 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)methyl]-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[(2,5-dichlorophenyl)methyl]-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 5017965 |
| Molecular Formula | C14H12Cl2FNO2S |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | N-[(2,5-dichlorophenyl)methyl]-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12Cl2FNO2S/c1-9-2-4-12(17)7-14(9)21(19,20)18-8-10-6-11(15)3-5-13(10)16/h2-7,18H,8H2,1H3 |
| InChIKey | PFHCMIGXKQYHJG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |