C14H12Cl2FNO2S — CID 64697782
[2-[(2,5-dichlorophenyl)sulfonylmethyl]-5-fluorophenyl]methanamine (PubChem CID 64697782) has the molecular formula C14H12Cl2FNO2S and a molecular weight of 348.23 g/mol. Its IUPAC name is [2-[(2,5-dichlorophenyl)sulfonylmethyl]-5-fluorophenyl]methanamine.
| Compound Name | [2-[(2,5-dichlorophenyl)sulfonylmethyl]-5-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 64697782 |
| Molecular Formula | C14H12Cl2FNO2S |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | [2-[(2,5-dichlorophenyl)sulfonylmethyl]-5-fluorophenyl]methanamine |
| SMILES | NCc1cc(F)ccc1CS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12Cl2FNO2S/c15-11-2-4-13(16)14(6-11)21(19,20)8-9-1-3-12(17)5-10(9)7-18/h1-6H,7-8,18H2 |
| InChIKey | OJMQFHJWORQKHR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |