C21H15BrF2N4O3S — CID 138700253
N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-bromo-4-methoxybenzenesulfonamide (PubChem CID 138700253) has the molecular formula C21H15BrF2N4O3S and a molecular weight of 521.34 g/mol. Its IUPAC name is N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-bromo-4-methoxybenzenesulfonamide.
| Compound Name | N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-bromo-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 138700253 |
| Molecular Formula | C21H15BrF2N4O3S |
| Molecular Weight | 521.34 g/mol |
| Exact Mass | 520.00 |
| IUPAC Name | N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-bromo-4-methoxybenzenesulfonamide |
| SMILES | [H]/N=C/c1cc(C#Cc2c(F)ccc(NS(=O)(=O)c3ccc(OC)c(Br)c3)c2F)cnc1N |
| InChI | InChI=1S/C21H15BrF2N4O3S/c1-31-19-7-3-14(9-16(19)22)32(29,30)28-18-6-5-17(23)15(20(18)24)4-2-12-8-13(10-25)21(26)27-11-12/h3,5-11,25,28H,1H3,(H2,26,27)/b25-10+ |
| InChIKey | KJIYABCMJZLEMT-KIBLKLHPSA-N |
| XLogP | 3.91 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|