C20H13ClF2N4OS — CID 134260500
N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-chlorobenzenesulfinamide (PubChem CID 134260500) has the molecular formula C20H13ClF2N4OS and a molecular weight of 430.87 g/mol. Its IUPAC name is N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-chlorobenzenesulfinamide.
| Compound Name | N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-chlorobenzenesulfinamide |
|---|---|
| PubChem CID | 134260500 |
| Molecular Formula | C20H13ClF2N4OS |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-chlorobenzenesulfinamide |
| SMILES | [H]/N=C/c1cc(C#Cc2c(F)ccc(NS(=O)c3cccc(Cl)c3)c2F)cnc1N |
| InChI | InChI=1S/C20H13ClF2N4OS/c21-14-2-1-3-15(9-14)29(28)27-18-7-6-17(22)16(19(18)23)5-4-12-8-13(10-24)20(25)26-11-12/h1-3,6-11,24,27H,(H2,25,26)/b24-10+ |
| InChIKey | LVZVFGTVXDTFEQ-YSURURNPSA-N |
| XLogP | 4.13 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|