C20H12F4N4OS — CID 138718290
N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3,5-difluorobenzenesulfinamide (PubChem CID 138718290) has the molecular formula C20H12F4N4OS and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3,5-difluorobenzenesulfinamide.
| Compound Name | N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3,5-difluorobenzenesulfinamide |
|---|---|
| PubChem CID | 138718290 |
| Molecular Formula | C20H12F4N4OS |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3,5-difluorobenzenesulfinamide |
| SMILES | [H]/N=C/c1cc(C#Cc2c(F)ccc(NS(=O)c3cc(F)cc(F)c3)c2F)cnc1N |
| InChI | InChI=1S/C20H12F4N4OS/c21-13-6-14(22)8-15(7-13)30(29)28-18-4-3-17(23)16(19(18)24)2-1-11-5-12(9-25)20(26)27-10-11/h3-10,25,28H,(H2,26,27)/b25-9+ |
| InChIKey | HAGHPOZWASDRNV-YCPBAFNGSA-N |
| XLogP | 3.75 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|