C21H12BrF5N4OS — CID 134260439
N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-bromo-5-(trifluoromethyl)benzenesulfinamide (PubChem CID 134260439) has the molecular formula C21H12BrF5N4OS and a molecular weight of 543.32 g/mol. Its IUPAC name is N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-bromo-5-(trifluoromethyl)benzenesulfinamide.
| Compound Name | N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-bromo-5-(trifluoromethyl)benzenesulfinamide |
|---|---|
| PubChem CID | 134260439 |
| Molecular Formula | C21H12BrF5N4OS |
| Molecular Weight | 543.32 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | N-[3-[2-(6-amino-5-methanimidoyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-3-bromo-5-(trifluoromethyl)benzenesulfinamide |
| SMILES | [H]/N=C/c1cc(C#Cc2c(F)ccc(NS(=O)c3cc(Br)cc(C(F)(F)F)c3)c2F)cnc1N |
| InChI | InChI=1S/C21H12BrF5N4OS/c22-14-6-13(21(25,26)27)7-15(8-14)33(32)31-18-4-3-17(23)16(19(18)24)2-1-11-5-12(9-28)20(29)30-10-11/h3-10,28,31H,(H2,29,30)/b28-9+ |
| InChIKey | SZGZCNKTEGSYNO-HIUVJMHLSA-N |
| XLogP | 5.26 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|