C14H12F3NO4S — CID 3855211
3,4-dimethoxy-N-(2,3,4-trifluorophenyl)benzenesulfonamide (PubChem CID 3855211) has the molecular formula C14H12F3NO4S and a molecular weight of 347.31 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2,3,4-trifluorophenyl)benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3855211 |
| Molecular Formula | C14H12F3NO4S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 3,4-dimethoxy-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C14H12F3NO4S/c1-21-11-6-3-8(7-12(11)22-2)23(19,20)18-10-5-4-9(15)13(16)14(10)17/h3-7,18H,1-2H3 |
| InChIKey | MIRSBWFCNOAFAD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|