C21H13ClFN5O2S — CID 170078771
5-chloro-N-[3-fluoro-4-(2-quinoxalin-2-ylethynyl)-2-pyridinyl]-2-methylpyridine-3-sulfonamide (PubChem CID 170078771) has the molecular formula C21H13ClFN5O2S and a molecular weight of 453.89 g/mol. Its IUPAC name is 5-chloro-N-[3-fluoro-4-(2-quinoxalin-2-ylethynyl)-2-pyridinyl]-2-methylpyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[3-fluoro-4-(2-quinoxalin-2-ylethynyl)-2-pyridinyl]-2-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 170078771 |
| Molecular Formula | C21H13ClFN5O2S |
| Molecular Weight | 453.89 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 5-chloro-N-[3-fluoro-4-(2-quinoxalin-2-ylethynyl)-2-pyridinyl]-2-methylpyridine-3-sulfonamide |
| SMILES | Cc1ncc(Cl)cc1S(=O)(=O)Nc1nccc(C#Cc2cnc3ccccc3n2)c1F |
| InChI | InChI=1S/C21H13ClFN5O2S/c1-13-19(10-15(22)11-25-13)31(29,30)28-21-20(23)14(8-9-24-21)6-7-16-12-26-17-4-2-3-5-18(17)27-16/h2-5,8-12H,1H3,(H,24,28) |
| InChIKey | MAIQXTDHCXZGOZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|