C13H10Cl2FNO3S — CID 107380788
N-(2,4-dichlorophenyl)-2-fluoro-4-(hydroxymethyl)benzenesulfonamide (PubChem CID 107380788) has the molecular formula C13H10Cl2FNO3S and a molecular weight of 350.20 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-fluoro-4-(hydroxymethyl)benzenesulfonamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-fluoro-4-(hydroxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107380788 |
| Molecular Formula | C13H10Cl2FNO3S |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-fluoro-4-(hydroxymethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1Cl)c1ccc(CO)cc1F |
| InChI | InChI=1S/C13H10Cl2FNO3S/c14-9-2-3-12(10(15)6-9)17-21(19,20)13-4-1-8(7-18)5-11(13)16/h1-6,17-18H,7H2 |
| InChIKey | QMFNPINYXMZYPY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |