C14H13ClFNO3S — CID 111444702
4-chloro-2-fluoro-N-[5-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide (PubChem CID 111444702) has the molecular formula C14H13ClFNO3S and a molecular weight of 329.78 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[5-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide.
| Compound Name | 4-chloro-2-fluoro-N-[5-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 111444702 |
| Molecular Formula | C14H13ClFNO3S |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 4-chloro-2-fluoro-N-[5-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide |
| SMILES | Cc1ccc(CO)cc1NS(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H13ClFNO3S/c1-9-2-3-10(8-18)6-13(9)17-21(19,20)14-5-4-11(15)7-12(14)16/h2-7,17-18H,8H2,1H3 |
| InChIKey | KQRQEGKKUYCLLQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |