C14H14ClNO3S — CID 111444701
2-chloro-N-[5-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide (PubChem CID 111444701) has the molecular formula C14H14ClNO3S and a molecular weight of 311.79 g/mol. Its IUPAC name is 2-chloro-N-[5-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[5-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 111444701 |
| Molecular Formula | C14H14ClNO3S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-chloro-N-[5-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide |
| SMILES | Cc1ccc(CO)cc1NS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H14ClNO3S/c1-10-6-7-11(9-17)8-13(10)16-20(18,19)14-5-3-2-4-12(14)15/h2-8,16-17H,9H2,1H3 |
| InChIKey | PUKVULZPMVSWSM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |