C15H16ClNO2S — CID 47308842
4-chloro-N-(2,5-dimethylphenyl)-2-methylbenzenesulfonamide (PubChem CID 47308842) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is 4-chloro-N-(2,5-dimethylphenyl)-2-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(2,5-dimethylphenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 47308842 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-chloro-N-(2,5-dimethylphenyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2ccc(Cl)cc2C)c1 |
| InChI | InChI=1S/C15H16ClNO2S/c1-10-4-5-11(2)14(8-10)17-20(18,19)15-7-6-13(16)9-12(15)3/h4-9,17H,1-3H3 |
| InChIKey | WJBNZELMMWCVFW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |