C14H18F2N2S2 — CID 166081433
1-N-(4,5-dimethylthiophen-3-yl)sulfanyl-2,4-difluorobenzene-1,3-diamine;ethane (PubChem CID 166081433) has the molecular formula C14H18F2N2S2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-N-(4,5-dimethylthiophen-3-yl)sulfanyl-2,4-difluorobenzene-1,3-diamine;ethane.
| Compound Name | 1-N-(4,5-dimethylthiophen-3-yl)sulfanyl-2,4-difluorobenzene-1,3-diamine;ethane |
|---|---|
| PubChem CID | 166081433 |
| Molecular Formula | C14H18F2N2S2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-N-(4,5-dimethylthiophen-3-yl)sulfanyl-2,4-difluorobenzene-1,3-diamine;ethane |
| SMILES | CC.Cc1scc(SNc2ccc(F)c(N)c2F)c1C |
| InChI | InChI=1S/C12H12F2N2S2.C2H6/c1-6-7(2)17-5-10(6)18-16-9-4-3-8(13)12(15)11(9)14;1-2/h3-5,16H,15H2,1-2H3;1-2H3 |
| InChIKey | LOPNLWYACYGXJH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|