C14H13F3N2O2S — CID 171763125
N-(3-amino-2,4-difluorophenyl)-3-fluoro-2,4-dimethylbenzenesulfonamide (PubChem CID 171763125) has the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-3-fluoro-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-3-fluoro-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 171763125 |
| Molecular Formula | C14H13F3N2O2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-3-fluoro-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(F)c(N)c2F)c(C)c1F |
| InChI | InChI=1S/C14H13F3N2O2S/c1-7-3-6-11(8(2)12(7)16)22(20,21)19-10-5-4-9(15)14(18)13(10)17/h3-6,19H,18H2,1-2H3 |
| InChIKey | VKEYDAWPVXXOQR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|