C11H13NOS — CID 130815462
(4,5-dimethylthiophen-3-yl)-(furan-3-yl)methanamine (PubChem CID 130815462) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is (4,5-dimethylthiophen-3-yl)-(furan-3-yl)methanamine.
| Compound Name | (4,5-dimethylthiophen-3-yl)-(furan-3-yl)methanamine |
|---|---|
| PubChem CID | 130815462 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (4,5-dimethylthiophen-3-yl)-(furan-3-yl)methanamine |
| SMILES | Cc1scc(C(N)c2ccoc2)c1C |
| InChI | InChI=1S/C11H13NOS/c1-7-8(2)14-6-10(7)11(12)9-3-4-13-5-9/h3-6,11H,12H2,1-2H3 |
| InChIKey | YKONUCZACJCJGR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |