C13H14BrNO — CID 114330324
(4-bromo-3,5-dimethylphenyl)-(furan-3-yl)methanamine (PubChem CID 114330324) has the molecular formula C13H14BrNO and a molecular weight of 280.17 g/mol. Its IUPAC name is (4-bromo-3,5-dimethylphenyl)-(furan-3-yl)methanamine.
| Compound Name | (4-bromo-3,5-dimethylphenyl)-(furan-3-yl)methanamine |
|---|---|
| PubChem CID | 114330324 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (4-bromo-3,5-dimethylphenyl)-(furan-3-yl)methanamine |
| SMILES | Cc1cc(C(N)c2ccoc2)cc(C)c1Br |
| InChI | InChI=1S/C13H14BrNO/c1-8-5-11(6-9(2)12(8)14)13(15)10-3-4-16-7-10/h3-7,13H,15H2,1-2H3 |
| InChIKey | ASDBXMHSJBZFRP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |